C8H17NO7 — CID 87421563
2-(1-aminoethoxy)-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 87421563) has the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-(1-aminoethoxy)-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | 2-(1-aminoethoxy)-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 87421563 |
| Molecular Formula | C8H17NO7 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(1-aminoethoxy)-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | CC(N)OC(C(=O)O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17NO7/c1-3(9)16-7(8(14)15)6(13)5(12)4(11)2-10/h3-7,10-13H,2,9H2,1H3,(H,14,15) |
| InChIKey | HMJPIYGCXVCLTK-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|