C10H23NO9 — CID 174656695
2-amino-3-hydroxybutanoic acid;hexane-1,2,3,4,5,6-hexol (PubChem CID 174656695) has the molecular formula C10H23NO9 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-amino-3-hydroxybutanoic acid;hexane-1,2,3,4,5,6-hexol.
| Compound Name | 2-amino-3-hydroxybutanoic acid;hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 174656695 |
| Molecular Formula | C10H23NO9 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-amino-3-hydroxybutanoic acid;hexane-1,2,3,4,5,6-hexol |
| SMILES | CC(O)C(N)C(=O)O.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O6.C4H9NO3/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(6)3(5)4(7)8/h3-12H,1-2H2;2-3,6H,5H2,1H3,(H,7,8) |
| InChIKey | QAELSFZDOPSLCR-UHFFFAOYSA-N |
| XLogP | -4.81 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |