C5H11NO5 — CID 11126623
(2S,3S,4S)-2-amino-3,4,5-trihydroxypentanoic acid (PubChem CID 11126623) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2S,3S,4S)-2-amino-3,4,5-trihydroxypentanoic acid.
| Compound Name | (2S,3S,4S)-2-amino-3,4,5-trihydroxypentanoic acid |
|---|---|
| PubChem CID | 11126623 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S,3S,4S)-2-amino-3,4,5-trihydroxypentanoic acid |
| SMILES | N[C@H](C(=O)O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H11NO5/c6-3(5(10)11)4(9)2(8)1-7/h2-4,7-9H,1,6H2,(H,10,11)/t2-,3-,4+/m0/s1 |
| InChIKey | LYCRDZDACLCUCZ-YVZJFKFKSA-N |
| XLogP | -2.89 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |