C9H19NO9 — CID 174478377
2-aminobutanedioic acid;pentane-1,2,3,4,5-pentol (PubChem CID 174478377) has the molecular formula C9H19NO9 and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-aminobutanedioic acid;pentane-1,2,3,4,5-pentol.
| Compound Name | 2-aminobutanedioic acid;pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174478377 |
| Molecular Formula | C9H19NO9 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-aminobutanedioic acid;pentane-1,2,3,4,5-pentol |
| SMILES | NC(CC(=O)O)C(=O)O.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C5H12O5.C4H7NO4/c6-1-3(8)5(10)4(9)2-7;5-2(4(8)9)1-3(6)7/h3-10H,1-2H2;2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | VCLBWMSKEYVOTA-UHFFFAOYSA-N |
| XLogP | -4.07 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |