C10H18N2O8 — CID 18346004
(3S,6R,7R,8S,9R)-3,6-diamino-7,8,9,10-tetrahydroxy-4,5-dioxodecanoic acid (PubChem CID 18346004) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is (3S,6R,7R,8S,9R)-3,6-diamino-7,8,9,10-tetrahydroxy-4,5-dioxodecanoic acid.
| Compound Name | (3S,6R,7R,8S,9R)-3,6-diamino-7,8,9,10-tetrahydroxy-4,5-dioxodecanoic acid |
|---|---|
| PubChem CID | 18346004 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3S,6R,7R,8S,9R)-3,6-diamino-7,8,9,10-tetrahydroxy-4,5-dioxodecanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)C(=O)[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18N2O8/c11-3(1-5(15)16)7(17)9(19)6(12)10(20)8(18)4(14)2-13/h3-4,6,8,10,13-14,18,20H,1-2,11-12H2,(H,15,16)/t3-,4+,6-,8+,10+/m0/s1 |
| InChIKey | BDQDHORBXISMHU-HQLFKQAASA-N |
| XLogP | -4.67 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|