C10H19NO6 — CID 87436465
(6R,7R,8S,9R)-6-amino-7,8,9,10-tetrahydroxydecane-4,5-dione (PubChem CID 87436465) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is (6R,7R,8S,9R)-6-amino-7,8,9,10-tetrahydroxydecane-4,5-dione.
| Compound Name | (6R,7R,8S,9R)-6-amino-7,8,9,10-tetrahydroxydecane-4,5-dione |
|---|---|
| PubChem CID | 87436465 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (6R,7R,8S,9R)-6-amino-7,8,9,10-tetrahydroxydecane-4,5-dione |
| SMILES | CCCC(=O)C(=O)[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H19NO6/c1-2-3-5(13)8(15)7(11)10(17)9(16)6(14)4-12/h6-7,9-10,12,14,16-17H,2-4,11H2,1H3/t6-,7+,9-,10-/m1/s1 |
| InChIKey | VQAUAHJIYXPKIP-BKFJMODKSA-N |
| XLogP | -2.67 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|