C18H34O7 — CID 174280560
1,2,3,4,5-pentahydroxyoctadecane-6,7-dione (PubChem CID 174280560) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is 1,2,3,4,5-pentahydroxyoctadecane-6,7-dione.
| Compound Name | 1,2,3,4,5-pentahydroxyoctadecane-6,7-dione |
|---|---|
| PubChem CID | 174280560 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1,2,3,4,5-pentahydroxyoctadecane-6,7-dione |
| SMILES | CCCCCCCCCCCC(=O)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H34O7/c1-2-3-4-5-6-7-8-9-10-11-13(20)15(22)17(24)18(25)16(23)14(21)12-19/h14,16-19,21,23-25H,2-12H2,1H3 |
| InChIKey | FYPOVDHIOFTFJR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|