C10H18O4 — CID 25023206
(2S)-1,2-dihydroxydecane-3,4-dione (PubChem CID 25023206) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2S)-1,2-dihydroxydecane-3,4-dione.
| Compound Name | (2S)-1,2-dihydroxydecane-3,4-dione |
|---|---|
| PubChem CID | 25023206 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2S)-1,2-dihydroxydecane-3,4-dione |
| SMILES | CCCCCCC(=O)C(=O)[C@@H](O)CO |
| InChI | InChI=1S/C10H18O4/c1-2-3-4-5-6-8(12)10(14)9(13)7-11/h9,11,13H,2-7H2,1H3/t9-/m0/s1 |
| InChIKey | LYNVJZRAVTWTEJ-VIFPVBQESA-N |
| XLogP | 0.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|