C9H16O4 — CID 56664339
1,2-dihydroxynonane-3,4-dione (PubChem CID 56664339) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 1,2-dihydroxynonane-3,4-dione.
| Compound Name | 1,2-dihydroxynonane-3,4-dione |
|---|---|
| PubChem CID | 56664339 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1,2-dihydroxynonane-3,4-dione |
| SMILES | CCCCCC(=O)C(=O)C(O)CO |
| InChI | InChI=1S/C9H16O4/c1-2-3-4-5-7(11)9(13)8(12)6-10/h8,10,12H,2-6H2,1H3 |
| InChIKey | LEXQXYUWMJSICB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|