About 6-hydroxypentadecane-7,8-dione
6-hydroxypentadecane-7,8-dione (PubChem CID 57116193) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-hydroxypentadecane-7,8-dione.
Molecular Properties
| Compound Name | 6-hydroxypentadecane-7,8-dione |
| PubChem CID | 57116193 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 6-hydroxypentadecane-7,8-dione |
| SMILES | CCCCCCCC(=O)C(=O)C(O)CCCCC |
| InChI | InChI=1S/C15H28O3/c1-3-5-7-8-10-12-14(17)15(18)13(16)11-9-6-4-2/h13,16H,3-12H2,1-2H3 |
| InChIKey | QANWEKMHLYUNLZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxypentadecane-7,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxypentadecane-7,8-dione?
The IUPAC name of 6-hydroxypentadecane-7,8-dione (CID 57116193) is 6-hydroxypentadecane-7,8-dione.
What is the SMILES notation for 6-hydroxypentadecane-7,8-dione?
The canonical SMILES for 6-hydroxypentadecane-7,8-dione is CCCCCCCC(=O)C(=O)C(O)CCCCC.
What is the InChIKey of 6-hydroxypentadecane-7,8-dione?
The InChIKey is QANWEKMHLYUNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-3-5-7-8-10-12-14(17)15(18)13(16)11-9-6-4-2/h13,16H,3-12H2,1-2H3.
What are the key properties of 6-hydroxypentadecane-7,8-dione?
6-hydroxypentadecane-7,8-dione has a molecular weight of 256.39 g/mol, XLogP of 3.43, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxypentadecane-7,8-dione is sourced from PubChem (CID 57116193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).