About azanium 2-hydroxydodecanoate
azanium 2-hydroxydodecanoate (PubChem CID 139935066) has the molecular formula C12H27NO3
and a molecular weight of 233.35 g/mol. Its IUPAC name is azanium 2-hydroxydodecanoate.
Molecular Properties
| Compound Name | azanium 2-hydroxydodecanoate |
| PubChem CID | 139935066 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | azanium 2-hydroxydodecanoate |
| SMILES | CCCCCCCCCCC(O)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C12H24O3.H3N/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11,13H,2-10H2,1H3,(H,14,15);1H3 |
| InChIKey | FSPFDTRPEHYKMW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azanium 2-hydroxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-hydroxydodecanoate?
The IUPAC name of azanium 2-hydroxydodecanoate (CID 139935066) is azanium 2-hydroxydodecanoate.
What is the SMILES notation for azanium 2-hydroxydodecanoate?
The canonical SMILES for azanium 2-hydroxydodecanoate is CCCCCCCCCCC(O)C(=O)[O-].[NH4+].
What is the InChIKey of azanium 2-hydroxydodecanoate?
The InChIKey is FSPFDTRPEHYKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3.H3N/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15;/h11,13H,2-10H2,1H3,(H,14,15);1H3.
What are the key properties of azanium 2-hydroxydodecanoate?
azanium 2-hydroxydodecanoate has a molecular weight of 233.35 g/mol, XLogP of 2.00, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-hydroxydodecanoate is sourced from PubChem (CID 139935066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).