C30H49O3- — CID 86583452
(12Z,15Z,18Z,21Z,24Z)-2-hydroxytriaconta-12,15,18,21,24-pentaenoate (PubChem CID 86583452) has the molecular formula C30H49O3- and a molecular weight of 457.72 g/mol. Its IUPAC name is (12Z,15Z,18Z,21Z,24Z)-2-hydroxytriaconta-12,15,18,21,24-pentaenoate.
| Compound Name | (12Z,15Z,18Z,21Z,24Z)-2-hydroxytriaconta-12,15,18,21,24-pentaenoate |
|---|---|
| PubChem CID | 86583452 |
| Molecular Formula | C30H49O3- |
| Molecular Weight | 457.72 g/mol |
| Exact Mass | 457.37 |
| IUPAC Name | (12Z,15Z,18Z,21Z,24Z)-2-hydroxytriaconta-12,15,18,21,24-pentaenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C30H50O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29(31)30(32)33/h6-7,9-10,12-13,15-16,18-19,29,31H,2-5,8,11,14,17,20-28H2,1H3,(H,32,33)/p-1/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | GZYKLSAPTLKGNM-WMPRHZDHSA-M |
| XLogP | 7.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.72 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|