C21H37O2- — CID 23175817
(9E,12E)-2-propan-2-yloctadeca-9,12-dienoate (PubChem CID 23175817) has the molecular formula C21H37O2- and a molecular weight of 321.53 g/mol. Its IUPAC name is (9E,12E)-2-propan-2-yloctadeca-9,12-dienoate.
| Compound Name | (9E,12E)-2-propan-2-yloctadeca-9,12-dienoate |
|---|---|
| PubChem CID | 23175817 |
| Molecular Formula | C21H37O2- |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | (9E,12E)-2-propan-2-yloctadeca-9,12-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCC(C(=O)[O-])C(C)C |
| InChI | InChI=1S/C21H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(19(2)3)21(22)23/h8-9,11-12,19-20H,4-7,10,13-18H2,1-3H3,(H,22,23)/p-1/b9-8+,12-11+ |
| InChIKey | RPMBTOFNVNWISO-MVKOLZDDSA-M |
| XLogP | 5.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|