(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid

C19H34O4 — CID 141316227

IUPAC(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCC(C(=O)O)C(O)O
InChIInChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h6-7,9-10,17-18,20-21H,2-5,8,11-16H2,1H3,(H,22,23)/b7-6-,10-9-
InChIKeyVHNJRYJSNVWYGR-HZJYTTRNSA-N
MW326.48 g/mol
LogP4.42
Rot. Bonds15

About (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid

(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid (PubChem CID 141316227) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid.

Molecular Properties

Compound Name(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid
PubChem CID141316227
Molecular FormulaC19H34O4
Molecular Weight326.48 g/mol
Exact Mass326.25
IUPAC Name(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCC(C(=O)O)C(O)O
InChIInChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h6-7,9-10,17-18,20-21H,2-5,8,11-16H2,1H3,(H,22,23)/b7-6-,10-9-
InChIKeyVHNJRYJSNVWYGR-HZJYTTRNSA-N
XLogP4.42
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds15
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.48
LogP ≤ 54.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid?
The IUPAC name of (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid (CID 141316227) is (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid.
What is the SMILES notation for (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid?
The canonical SMILES for (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid is CCCCC/C=C\C/C=C\CCCCCCC(C(=O)O)C(O)O.
What is the InChIKey of (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid?
The InChIKey is VHNJRYJSNVWYGR-HZJYTTRNSA-N. The full InChI is InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h6-7,9-10,17-18,20-21H,2-5,8,11-16H2,1H3,(H,22,23)/b7-6-,10-9-.
What are the key properties of (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid?
(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid has a molecular weight of 326.48 g/mol, XLogP of 4.42, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid is sourced from PubChem (CID 141316227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).