C19H34O4 — CID 141316227
(9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid (PubChem CID 141316227) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 141316227 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (9Z,12Z)-2-(dihydroxymethyl)octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C(=O)O)C(O)O |
| InChI | InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h6-7,9-10,17-18,20-21H,2-5,8,11-16H2,1H3,(H,22,23)/b7-6-,10-9- |
| InChIKey | VHNJRYJSNVWYGR-HZJYTTRNSA-N |
| XLogP | 4.42 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|