C28H50O4 — CID 177312923
2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-(6-methylheptyl)butanedioic acid (PubChem CID 177312923) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-(6-methylheptyl)butanedioic acid.
| Compound Name | 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-(6-methylheptyl)butanedioic acid |
|---|---|
| PubChem CID | 177312923 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-(6-methylheptyl)butanedioic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C(=O)O)C(CCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/C28H50O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-25(27(29)30)26(28(31)32)23-20-17-18-21-24(2)3/h8-9,11-12,24-26H,4-7,10,13-23H2,1-3H3,(H,29,30)(H,31,32)/b9-8-,12-11- |
| InChIKey | YGOWXCDYUREVRO-MURFETPASA-N |
| XLogP | 8.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|