C21H39NO — CID 175746328
2-methylicosa-11,14-dienamide (PubChem CID 175746328) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 2-methylicosa-11,14-dienamide.
| Compound Name | 2-methylicosa-11,14-dienamide |
|---|---|
| PubChem CID | 175746328 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 2-methylicosa-11,14-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(C)C(N)=O |
| InChI | InChI=1S/C21H39NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21(22)23/h7-8,10-11,20H,3-6,9,12-19H2,1-2H3,(H2,22,23) |
| InChIKey | KQXWLLGHPMSAJT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|