C25H42O — CID 123315985
6-methyltetracosa-10,13,16,19-tetraen-7-one (PubChem CID 123315985) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is 6-methyltetracosa-10,13,16,19-tetraen-7-one.
| Compound Name | 6-methyltetracosa-10,13,16,19-tetraen-7-one |
|---|---|
| PubChem CID | 123315985 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | 6-methyltetracosa-10,13,16,19-tetraen-7-one |
| SMILES | CCCCC=CCC=CCC=CCC=CCCC(=O)C(C)CCCCC |
| InChI | InChI=1S/C25H42O/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-21-23-25(26)24(3)22-20-7-5-2/h9-10,12-13,15-16,18-19,24H,4-8,11,14,17,20-23H2,1-3H3 |
| InChIKey | LFRUMDDSXQQZLP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|