(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid

C22H34O2 — CID 122651983

IUPAC(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid
SMILESCCCCC/C=C/C/C=C\C/C=C\C/C=C\C/C=C/CCC(=O)O
InChIInChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,18-19H,2-5,8,11,14,17,20-21H2,1H3,(H,23,24)/b7-6+,10-9-,13-12-,16-15-,19-18+
InChIKeyAVKOENOBFIYBSA-UBASBNDLSA-N
MW330.51 g/mol
LogP6.77
Rot. Bonds15

About (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid

(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid (PubChem CID 122651983) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid.

Molecular Properties

Compound Name(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid
PubChem CID122651983
Molecular FormulaC22H34O2
Molecular Weight330.51 g/mol
Exact Mass330.26
IUPAC Name(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid
SMILESCCCCC/C=C/C/C=C\C/C=C\C/C=C\C/C=C/CCC(=O)O
InChIInChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,18-19H,2-5,8,11,14,17,20-21H2,1H3,(H,23,24)/b7-6+,10-9-,13-12-,16-15-,19-18+
InChIKeyAVKOENOBFIYBSA-UBASBNDLSA-N
XLogP6.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds15
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500330.51
LogP ≤ 56.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid?
The IUPAC name of (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid (CID 122651983) is (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid.
What is the SMILES notation for (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid?
The canonical SMILES for (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid is CCCCC/C=C/C/C=C\C/C=C\C/C=C\C/C=C/CCC(=O)O.
What is the InChIKey of (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid?
The InChIKey is AVKOENOBFIYBSA-UBASBNDLSA-N. The full InChI is InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,18-19H,2-5,8,11,14,17,20-21H2,1H3,(H,23,24)/b7-6+,10-9-,13-12-,16-15-,19-18+.
What are the key properties of (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid?
(4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid has a molecular weight of 330.51 g/mol, XLogP of 6.77, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,7Z,10Z,13Z,16E)-docosa-4,7,10,13,16-pentaenoic acid is sourced from PubChem (CID 122651983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).