C20H32O2 — CID 122652036
(5Z,8E,11E,14Z)-icosa-5,8,11,14-tetraenoic acid (PubChem CID 122652036) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (5Z,8E,11E,14Z)-icosa-5,8,11,14-tetraenoic acid.
| Compound Name | (5Z,8E,11E,14Z)-icosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 122652036 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (5Z,8E,11E,14Z)-icosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C=C/C/C=C/C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9+,13-12+,16-15- |
| InChIKey | YZXBAPSDXZZRGB-MSMXDPMDSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|