octadeca-5,8,12-trienoic acid

C18H30O2 — CID 173410931

IUPACoctadeca-5,8,12-trienoic acid
SMILESCCCCCC=CCCC=CCC=CCCCC(=O)O
InChIInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,10-11,13-14H,2-5,8-9,12,15-17H2,1H3,(H,19,20)
InChIKeyVMGVPZMDEVGJPX-UHFFFAOYSA-N
MW278.44 g/mol
LogP5.66
Rot. Bonds13

About octadeca-5,8,12-trienoic acid

octadeca-5,8,12-trienoic acid (PubChem CID 173410931) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is octadeca-5,8,12-trienoic acid.

Molecular Properties

Compound Nameoctadeca-5,8,12-trienoic acid
PubChem CID173410931
Molecular FormulaC18H30O2
Molecular Weight278.44 g/mol
Exact Mass278.22
IUPAC Nameoctadeca-5,8,12-trienoic acid
SMILESCCCCCC=CCCC=CCC=CCCCC(=O)O
InChIInChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,10-11,13-14H,2-5,8-9,12,15-17H2,1H3,(H,19,20)
InChIKeyVMGVPZMDEVGJPX-UHFFFAOYSA-N
XLogP5.66
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500278.44
LogP ≤ 55.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze octadeca-5,8,12-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octadeca-5,8,12-trienoic acid?
The IUPAC name of octadeca-5,8,12-trienoic acid (CID 173410931) is octadeca-5,8,12-trienoic acid.
What is the SMILES notation for octadeca-5,8,12-trienoic acid?
The canonical SMILES for octadeca-5,8,12-trienoic acid is CCCCCC=CCCC=CCC=CCCCC(=O)O.
What is the InChIKey of octadeca-5,8,12-trienoic acid?
The InChIKey is VMGVPZMDEVGJPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,10-11,13-14H,2-5,8-9,12,15-17H2,1H3,(H,19,20).
What are the key properties of octadeca-5,8,12-trienoic acid?
octadeca-5,8,12-trienoic acid has a molecular weight of 278.44 g/mol, XLogP of 5.66, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-5,8,12-trienoic acid is sourced from PubChem (CID 173410931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).