C20H34O4 — CID 173088002
hydrogen peroxide;icosa-5,8,11,14-tetraenoic acid (PubChem CID 173088002) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is hydrogen peroxide;icosa-5,8,11,14-tetraenoic acid.
| Compound Name | hydrogen peroxide;icosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 173088002 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | hydrogen peroxide;icosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O.OO |
| InChI | InChI=1S/C20H32O2.H2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;1-2/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22);1-2H |
| InChIKey | ZEDHCYYJFICLPC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|