C20H32O2 — CID 101342439
(5Z,8Z,11Z,14Z)-(1113C)icosa-5,8,11,14-tetraenoic acid (PubChem CID 101342439) has the molecular formula C20H32O2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-(1113C)icosa-5,8,11,14-tetraenoic acid.
| Compound Name | (5Z,8Z,11Z,14Z)-(1113C)icosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 101342439 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-(1113C)icosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C=[13CH]\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15-/i10+1 |
| InChIKey | YZXBAPSDXZZRGB-GJWFZPSTSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|