C22H34O2 — CID 5282848
(4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoic acid (PubChem CID 5282848) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoic acid.
| Compound Name | (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoic acid |
|---|---|
| PubChem CID | 5282848 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoic acid |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O |
| InChI | InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,18-19H,2-5,8,11,14,17,20-21H2,1H3,(H,23,24)/b7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | AVKOENOBFIYBSA-GUTOPQIJSA-N |
| XLogP | 6.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|