C22H38O — CID 155312053
(9Z,12Z,15Z)-3-methylhenicosa-9,12,15-trien-4-one (PubChem CID 155312053) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (9Z,12Z,15Z)-3-methylhenicosa-9,12,15-trien-4-one.
| Compound Name | (9Z,12Z,15Z)-3-methylhenicosa-9,12,15-trien-4-one |
|---|---|
| PubChem CID | 155312053 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (9Z,12Z,15Z)-3-methylhenicosa-9,12,15-trien-4-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)C(C)CC |
| InChI | InChI=1S/C22H38O/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)21(3)5-2/h9-10,12-13,15-16,21H,4-8,11,14,17-20H2,1-3H3/b10-9-,13-12-,16-15- |
| InChIKey | YFQLFFIIHAXUBO-YOILPLPUSA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|