C39H68O5 — CID 173372072
19,20,21-trihydroxynonatriaconta-6,9,30,33-tetraene-18,22-dione (PubChem CID 173372072) has the molecular formula C39H68O5 and a molecular weight of 616.97 g/mol. Its IUPAC name is 19,20,21-trihydroxynonatriaconta-6,9,30,33-tetraene-18,22-dione.
| Compound Name | 19,20,21-trihydroxynonatriaconta-6,9,30,33-tetraene-18,22-dione |
|---|---|
| PubChem CID | 173372072 |
| Molecular Formula | C39H68O5 |
| Molecular Weight | 616.97 g/mol |
| Exact Mass | 616.51 |
| IUPAC Name | 19,20,21-trihydroxynonatriaconta-6,9,30,33-tetraene-18,22-dione |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)C(O)C(O)C(O)C(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C39H68O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(40)37(42)39(44)38(43)36(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,37-39,42-44H,3-10,15-16,21-34H2,1-2H3 |
| InChIKey | IXXJTYMESJXCLR-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.97 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|