C23H39NO3 — CID 124674987
(2S,3R,8Z,11Z,14Z,17Z)-2-amino-1,3-dihydroxytricosa-8,11,14,17-tetraen-4-one (PubChem CID 124674987) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is (2S,3R,8Z,11Z,14Z,17Z)-2-amino-1,3-dihydroxytricosa-8,11,14,17-tetraen-4-one.
| Compound Name | (2S,3R,8Z,11Z,14Z,17Z)-2-amino-1,3-dihydroxytricosa-8,11,14,17-tetraen-4-one |
|---|---|
| PubChem CID | 124674987 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | (2S,3R,8Z,11Z,14Z,17Z)-2-amino-1,3-dihydroxytricosa-8,11,14,17-tetraen-4-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C23H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)23(27)21(24)20-25/h6-7,9-10,12-13,15-16,21,23,25,27H,2-5,8,11,14,17-20,24H2,1H3/b7-6-,10-9-,13-12-,16-15-/t21-,23+/m0/s1 |
| InChIKey | CTRJAGWPSCACGW-VLBAZDKSSA-N |
| XLogP | 4.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|