C39H72O2 — CID 87602106
(9Z,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione (PubChem CID 87602106) has the molecular formula C39H72O2 and a molecular weight of 573.00 g/mol. Its IUPAC name is (9Z,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione.
| Compound Name | (9Z,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione |
|---|---|
| PubChem CID | 87602106 |
| Molecular Formula | C39H72O2 |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 572.55 |
| IUPAC Name | (9Z,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(C)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H72O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(40)36-37(3)39(41)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,37H,4-17,22-36H2,1-3H3/b20-18-,21-19- |
| InChIKey | KNKRBLSRMQCBDM-AUYXYSRISA-N |
| XLogP | 13.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|