C42H81NO2 — CID 138683043
N,N-dimethylmethanamine;(9Z,19R,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione (PubChem CID 138683043) has the molecular formula C42H81NO2 and a molecular weight of 632.12 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(9Z,19R,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione.
| Compound Name | N,N-dimethylmethanamine;(9Z,19R,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione |
|---|---|
| PubChem CID | 138683043 |
| Molecular Formula | C42H81NO2 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 631.63 |
| IUPAC Name | N,N-dimethylmethanamine;(9Z,19R,29Z)-19-methyloctatriaconta-9,29-diene-18,21-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C[C@@H](C)C(=O)CCCCCCC/C=C\CCCCCCCC.CN(C)C |
| InChI | InChI=1S/C39H72O2.C3H9N/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(40)36-37(3)39(41)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-4(2)3/h18-21,37H,4-17,22-36H2,1-3H3;1-3H3/b20-18-,21-19-;/t37-;/m1./s1 |
| InChIKey | CNSURCFVJDVTJI-KSTCMLFKSA-N |
| XLogP | 13.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|