C42H78N2O3 — CID 135145236
(Z)-2-(dimethylamino)-3-[(Z)-octadec-9-enoyl]-5-oxodocos-13-enamide (PubChem CID 135145236) has the molecular formula C42H78N2O3 and a molecular weight of 659.10 g/mol. Its IUPAC name is (Z)-2-(dimethylamino)-3-[(Z)-octadec-9-enoyl]-5-oxodocos-13-enamide.
| Compound Name | (Z)-2-(dimethylamino)-3-[(Z)-octadec-9-enoyl]-5-oxodocos-13-enamide |
|---|---|
| PubChem CID | 135145236 |
| Molecular Formula | C42H78N2O3 |
| Molecular Weight | 659.10 g/mol |
| Exact Mass | 658.60 |
| IUPAC Name | (Z)-2-(dimethylamino)-3-[(Z)-octadec-9-enoyl]-5-oxodocos-13-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(C(=O)CCCCCCC/C=C\CCCCCCCC)C(C(N)=O)N(C)C |
| InChI | InChI=1S/C42H78N2O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(45)37-39(41(42(43)47)44(3)4)40(46)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,39,41H,5-18,23-37H2,1-4H3,(H2,43,47)/b21-19-,22-20- |
| InChIKey | RUCXHYPVEKBCCR-WRBBJXAJSA-N |
| XLogP | 11.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.10 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|