C42H80ClNO2 — CID 174966673
(9Z,29Z)-19-[2-(dimethylamino)ethyl]octatriaconta-9,29-diene-18,21-dione;hydrochloride (PubChem CID 174966673) has the molecular formula C42H80ClNO2 and a molecular weight of 666.56 g/mol. Its IUPAC name is (9Z,29Z)-19-[2-(dimethylamino)ethyl]octatriaconta-9,29-diene-18,21-dione;hydrochloride.
| Compound Name | (9Z,29Z)-19-[2-(dimethylamino)ethyl]octatriaconta-9,29-diene-18,21-dione;hydrochloride |
|---|---|
| PubChem CID | 174966673 |
| Molecular Formula | C42H80ClNO2 |
| Molecular Weight | 666.56 g/mol |
| Exact Mass | 665.59 |
| IUPAC Name | (9Z,29Z)-19-[2-(dimethylamino)ethyl]octatriaconta-9,29-diene-18,21-dione;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(CCN(C)C)C(=O)CCCCCCC/C=C\CCCCCCCC.Cl |
| InChI | InChI=1S/C42H79NO2.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(44)39-40(37-38-43(3)4)42(45)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22,40H,5-18,23-39H2,1-4H3;1H/b21-19-,22-20-; |
| InChIKey | MSMWIPOTNKHWSX-JDVCJPALSA-N |
| XLogP | 13.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.56 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|