C45H81NO5 — CID 25152611
6-[[(Z)-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enyl]amino]-6-oxohexanoic acid (PubChem CID 25152611) has the molecular formula C45H81NO5 and a molecular weight of 716.14 g/mol. Its IUPAC name is 6-[[(Z)-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enyl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[[(Z)-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enyl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 25152611 |
| Molecular Formula | C45H81NO5 |
| Molecular Weight | 716.14 g/mol |
| Exact Mass | 715.61 |
| IUPAC Name | 6-[[(Z)-2-[(Z)-octadec-9-enoyl]-4-oxohenicos-12-enyl]amino]-6-oxohexanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CC(CNC(=O)CCCCC(=O)O)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H81NO5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-42(47)39-41(40-46-44(49)37-33-34-38-45(50)51)43(48)36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,41H,3-16,21-40H2,1-2H3,(H,46,49)(H,50,51)/b19-17-,20-18- |
| InChIKey | FPLIZDGDYXDEJW-CLFAGFIQSA-N |
| XLogP | 12.97 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.14 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|