C42H80N2O2 — CID 141159547
3-methyl-2,4-bis[(Z)-octadec-9-enyl]pentanediamide (PubChem CID 141159547) has the molecular formula C42H80N2O2 and a molecular weight of 645.11 g/mol. Its IUPAC name is 3-methyl-2,4-bis[(Z)-octadec-9-enyl]pentanediamide.
| Compound Name | 3-methyl-2,4-bis[(Z)-octadec-9-enyl]pentanediamide |
|---|---|
| PubChem CID | 141159547 |
| Molecular Formula | C42H80N2O2 |
| Molecular Weight | 645.11 g/mol |
| Exact Mass | 644.62 |
| IUPAC Name | 3-methyl-2,4-bis[(Z)-octadec-9-enyl]pentanediamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C(N)=O)C(C)C(CCCCCCCC/C=C\CCCCCCCC)C(N)=O |
| InChI | InChI=1S/C42H80N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(41(43)45)38(3)40(42(44)46)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,38-40H,4-17,22-37H2,1-3H3,(H2,43,45)(H2,44,46)/b20-18-,21-19- |
| InChIKey | DVNPNSDOEIHOOV-AUYXYSRISA-N |
| XLogP | 12.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.11 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|