C32H62N2O2 — CID 175075268
(Z)-N-(3-carbamoyltridecan-2-yl)octadec-9-enamide (PubChem CID 175075268) has the molecular formula C32H62N2O2 and a molecular weight of 506.86 g/mol. Its IUPAC name is (Z)-N-(3-carbamoyltridecan-2-yl)octadec-9-enamide.
| Compound Name | (Z)-N-(3-carbamoyltridecan-2-yl)octadec-9-enamide |
|---|---|
| PubChem CID | 175075268 |
| Molecular Formula | C32H62N2O2 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.48 |
| IUPAC Name | (Z)-N-(3-carbamoyltridecan-2-yl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(C)C(CCCCCCCCCC)C(N)=O |
| InChI | InChI=1S/C32H62N2O2/c1-4-6-8-10-12-14-15-16-17-18-19-20-22-24-26-28-31(35)34-29(3)30(32(33)36)27-25-23-21-13-11-9-7-5-2/h16-17,29-30H,4-15,18-28H2,1-3H3,(H2,33,36)(H,34,35)/b17-16- |
| InChIKey | TZKIOIHVRCRPDH-MSUUIHNZSA-N |
| XLogP | 9.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|