C22H43N3O2 — CID 58668219
(Z)-N-[(2S)-1,4-diamino-1-oxobutan-2-yl]octadec-9-enamide (PubChem CID 58668219) has the molecular formula C22H43N3O2 and a molecular weight of 381.61 g/mol. Its IUPAC name is (Z)-N-[(2S)-1,4-diamino-1-oxobutan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[(2S)-1,4-diamino-1-oxobutan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 58668219 |
| Molecular Formula | C22H43N3O2 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | (Z)-N-[(2S)-1,4-diamino-1-oxobutan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCN)C(N)=O |
| InChI | InChI=1S/C22H43N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(26)25-20(18-19-23)22(24)27/h9-10,20H,2-8,11-19,23H2,1H3,(H2,24,27)(H,25,26)/b10-9-/t20-/m0/s1 |
| InChIKey | GIXCHNDPHMNVCK-QJRAZLAKSA-N |
| XLogP | 4.34 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|