C14H29N3O2 — CID 142575651
N-[(2R)-1,4-diamino-1-oxobutan-2-yl]decanamide (PubChem CID 142575651) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(2R)-1,4-diamino-1-oxobutan-2-yl]decanamide.
| Compound Name | N-[(2R)-1,4-diamino-1-oxobutan-2-yl]decanamide |
|---|---|
| PubChem CID | 142575651 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(2R)-1,4-diamino-1-oxobutan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@H](CCN)C(N)=O |
| InChI | InChI=1S/C14H29N3O2/c1-2-3-4-5-6-7-8-9-13(18)17-12(10-11-15)14(16)19/h12H,2-11,15H2,1H3,(H2,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | LPJMLPYJKGJZFZ-GFCCVEGCSA-N |
| XLogP | 1.45 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|