About (2R)-2-hydroxyheptanoate
(2R)-2-hydroxyheptanoate (PubChem CID 7054559) has the molecular formula C7H13O3-
and a molecular weight of 145.18 g/mol. Its IUPAC name is (2R)-2-hydroxyheptanoate.
Molecular Properties
| Compound Name | (2R)-2-hydroxyheptanoate |
| PubChem CID | 7054559 |
| Molecular Formula | C7H13O3- |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (2R)-2-hydroxyheptanoate |
| SMILES | CCCCC[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C7H14O3/c1-2-3-4-5-6(8)7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/p-1/t6-/m1/s1 |
| InChIKey | RGMMREBHCYXQMA-ZCFIWIBFSA-M |
| XLogP | -0.32 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-hydroxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxyheptanoate?
The IUPAC name of (2R)-2-hydroxyheptanoate (CID 7054559) is (2R)-2-hydroxyheptanoate.
What is the SMILES notation for (2R)-2-hydroxyheptanoate?
The canonical SMILES for (2R)-2-hydroxyheptanoate is CCCCC[C@@H](O)C(=O)[O-].
What is the InChIKey of (2R)-2-hydroxyheptanoate?
The InChIKey is RGMMREBHCYXQMA-ZCFIWIBFSA-M. The full InChI is InChI=1S/C7H14O3/c1-2-3-4-5-6(8)7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/p-1/t6-/m1/s1.
What are the key properties of (2R)-2-hydroxyheptanoate?
(2R)-2-hydroxyheptanoate has a molecular weight of 145.18 g/mol, XLogP of -0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxyheptanoate is sourced from PubChem (CID 7054559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).