C17H33NO7 — CID 141113312
N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]undecanamide (PubChem CID 141113312) has the molecular formula C17H33NO7 and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]undecanamide.
| Compound Name | N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]undecanamide |
|---|---|
| PubChem CID | 141113312 |
| Molecular Formula | C17H33NO7 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]undecanamide |
| SMILES | CCCCCCCCCCC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H33NO7/c1-2-3-4-5-6-7-8-9-10-13(21)18-17(25)16(24)15(23)14(22)12(20)11-19/h12,14-16,19-20,22-24H,2-11H2,1H3,(H,18,21,25)/t12-,14-,15+,16-/m1/s1 |
| InChIKey | QIXMDKJYISIOEN-DMRZNYOFSA-N |
| XLogP | -0.40 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|