C9H17NO7 — CID 18658603
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-propanoylhexanamide (PubChem CID 18658603) has the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-propanoylhexanamide.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-propanoylhexanamide |
|---|---|
| PubChem CID | 18658603 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-propanoylhexanamide |
| SMILES | CCC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO7/c1-2-5(13)10-9(17)8(16)7(15)6(14)4(12)3-11/h4,6-8,11-12,14-16H,2-3H2,1H3,(H,10,13,17)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | LJOYAAMOFPIBEG-CCXZUQQUSA-N |
| XLogP | -3.52 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |