C12H23NO9 — CID 90896461
N-(1,2,3,4,7,8,9-heptahydroxy-6-oxononan-5-yl)propanamide (PubChem CID 90896461) has the molecular formula C12H23NO9 and a molecular weight of 325.31 g/mol. Its IUPAC name is N-(1,2,3,4,7,8,9-heptahydroxy-6-oxononan-5-yl)propanamide.
| Compound Name | N-(1,2,3,4,7,8,9-heptahydroxy-6-oxononan-5-yl)propanamide |
|---|---|
| PubChem CID | 90896461 |
| Molecular Formula | C12H23NO9 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(1,2,3,4,7,8,9-heptahydroxy-6-oxononan-5-yl)propanamide |
| SMILES | CCC(=O)NC(C(=O)C(O)C(O)CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H23NO9/c1-2-7(18)13-8(11(21)9(19)5(16)3-14)12(22)10(20)6(17)4-15/h5-6,8-11,14-17,19-21H,2-4H2,1H3,(H,13,18) |
| InChIKey | CGJVDMAOQXBUHU-UHFFFAOYSA-N |
| XLogP | -4.76 |
| TPSA | 187.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |