C8H16N2O5 — CID 140531712
N'-(3,4,5-trihydroxy-2-oxopentyl)propanehydrazide (PubChem CID 140531712) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is N'-(3,4,5-trihydroxy-2-oxopentyl)propanehydrazide.
| Compound Name | N'-(3,4,5-trihydroxy-2-oxopentyl)propanehydrazide |
|---|---|
| PubChem CID | 140531712 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N'-(3,4,5-trihydroxy-2-oxopentyl)propanehydrazide |
| SMILES | CCC(=O)NNCC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C8H16N2O5/c1-2-7(14)10-9-3-5(12)8(15)6(13)4-11/h6,8-9,11,13,15H,2-4H2,1H3,(H,10,14) |
| InChIKey | GVLFMEYFEUGWJB-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|