C5H13O5P — CID 170344505
phosphane;1,3,4,5-tetrahydroxypentan-2-one (PubChem CID 170344505) has the molecular formula C5H13O5P and a molecular weight of 184.13 g/mol. Its IUPAC name is phosphane;1,3,4,5-tetrahydroxypentan-2-one.
| Compound Name | phosphane;1,3,4,5-tetrahydroxypentan-2-one |
|---|---|
| PubChem CID | 170344505 |
| Molecular Formula | C5H13O5P |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | phosphane;1,3,4,5-tetrahydroxypentan-2-one |
| SMILES | O=C(CO)C(O)C(O)CO.P |
| InChI | InChI=1S/C5H10O5.H3P/c6-1-3(8)5(10)4(9)2-7;/h3,5-8,10H,1-2H2;1H3 |
| InChIKey | GLPYMLRWXFPYNH-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|