C5H9FO4 — CID 130737250
(3S)-5-fluoro-1,3,4-trihydroxypentan-2-one (PubChem CID 130737250) has the molecular formula C5H9FO4 and a molecular weight of 152.12 g/mol. Its IUPAC name is (3S)-5-fluoro-1,3,4-trihydroxypentan-2-one.
| Compound Name | (3S)-5-fluoro-1,3,4-trihydroxypentan-2-one |
|---|---|
| PubChem CID | 130737250 |
| Molecular Formula | C5H9FO4 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (3S)-5-fluoro-1,3,4-trihydroxypentan-2-one |
| SMILES | O=C(CO)[C@@H](O)C(O)CF |
| InChI | InChI=1S/C5H9FO4/c6-1-3(8)5(10)4(9)2-7/h3,5,7-8,10H,1-2H2/t3?,5-/m0/s1 |
| InChIKey | DZPAPJMTQBXJAM-PVPKANODSA-N |
| XLogP | -1.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |