C6H9NO4 — CID 10931716
(3R,4S)-3,4,6-trihydroxy-5-oxohexanenitrile (PubChem CID 10931716) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is (3R,4S)-3,4,6-trihydroxy-5-oxohexanenitrile.
| Compound Name | (3R,4S)-3,4,6-trihydroxy-5-oxohexanenitrile |
|---|---|
| PubChem CID | 10931716 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (3R,4S)-3,4,6-trihydroxy-5-oxohexanenitrile |
| SMILES | N#CC[C@@H](O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C6H9NO4/c7-2-1-4(9)6(11)5(10)3-8/h4,6,8-9,11H,1,3H2/t4-,6+/m1/s1 |
| InChIKey | JZNLQQGTGIBCLH-XINAWCOVSA-N |
| XLogP | -1.82 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |