C5H10O4 — CID 101111958
(3R,4S)-1,3,4-trihydroxypentan-2-one (PubChem CID 101111958) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (3R,4S)-1,3,4-trihydroxypentan-2-one.
| Compound Name | (3R,4S)-1,3,4-trihydroxypentan-2-one |
|---|---|
| PubChem CID | 101111958 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (3R,4S)-1,3,4-trihydroxypentan-2-one |
| SMILES | C[C@H](O)[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C5H10O4/c1-3(7)5(9)4(8)2-6/h3,5-7,9H,2H2,1H3/t3-,5+/m0/s1 |
| InChIKey | MRKRITSFTIHTAQ-WVZVXSGGSA-N |
| XLogP | -1.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |