C8H16O3 — CID 174421327
4-ethyl-1,3-dihydroxyhexan-2-one (PubChem CID 174421327) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 4-ethyl-1,3-dihydroxyhexan-2-one.
| Compound Name | 4-ethyl-1,3-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 174421327 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 4-ethyl-1,3-dihydroxyhexan-2-one |
| SMILES | CCC(CC)C(O)C(=O)CO |
| InChI | InChI=1S/C8H16O3/c1-3-6(4-2)8(11)7(10)5-9/h6,8-9,11H,3-5H2,1-2H3 |
| InChIKey | CRBVGYFNUVOOHR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |