About 4-ethyl-1,3-dihydroxyhexan-2-one
4-ethyl-1,3-dihydroxyhexan-2-one (PubChem CID 174421327) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 4-ethyl-1,3-dihydroxyhexan-2-one.
Molecular Properties
| Compound Name | 4-ethyl-1,3-dihydroxyhexan-2-one |
| PubChem CID | 174421327 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 4-ethyl-1,3-dihydroxyhexan-2-one |
| SMILES | CCC(CC)C(O)C(=O)CO |
| InChI | InChI=1S/C8H16O3/c1-3-6(4-2)8(11)7(10)5-9/h6,8-9,11H,3-5H2,1-2H3 |
| InChIKey | CRBVGYFNUVOOHR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1,3-dihydroxyhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,3-dihydroxyhexan-2-one?
The IUPAC name of 4-ethyl-1,3-dihydroxyhexan-2-one (CID 174421327) is 4-ethyl-1,3-dihydroxyhexan-2-one.
What is the SMILES notation for 4-ethyl-1,3-dihydroxyhexan-2-one?
The canonical SMILES for 4-ethyl-1,3-dihydroxyhexan-2-one is CCC(CC)C(O)C(=O)CO.
What is the InChIKey of 4-ethyl-1,3-dihydroxyhexan-2-one?
The InChIKey is CRBVGYFNUVOOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-6(4-2)8(11)7(10)5-9/h6,8-9,11H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-1,3-dihydroxyhexan-2-one?
4-ethyl-1,3-dihydroxyhexan-2-one has a molecular weight of 160.21 g/mol, XLogP of 0.34, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,3-dihydroxyhexan-2-one is sourced from PubChem (CID 174421327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).