C6H10Ac3O5 — CID 59039792
actinium;(3R,4R)-1,3,4-trihydroxyhexane-2,5-dione (PubChem CID 59039792) has the molecular formula C6H10Ac3O5 and a molecular weight of 843.14 g/mol. Its IUPAC name is actinium;(3R,4R)-1,3,4-trihydroxyhexane-2,5-dione.
| Compound Name | actinium;(3R,4R)-1,3,4-trihydroxyhexane-2,5-dione |
|---|---|
| PubChem CID | 59039792 |
| Molecular Formula | C6H10Ac3O5 |
| Molecular Weight | 843.14 g/mol |
| Exact Mass | 843.14 |
| IUPAC Name | actinium;(3R,4R)-1,3,4-trihydroxyhexane-2,5-dione |
| SMILES | CC(=O)[C@H](O)[C@@H](O)C(=O)CO.[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C6H10O5.3Ac/c1-3(8)5(10)6(11)4(9)2-7;;;/h5-7,10-11H,2H2,1H3;;;/t5-,6-;;;/m0.../s1 |
| InChIKey | ARBMLMRFMDPEAQ-VDBFCSKJSA-N |
| XLogP | -2.14 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.14 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |