C5H7ClO3 — CID 167631445
3-chloro-1-hydroxypentane-2,4-dione (PubChem CID 167631445) has the molecular formula C5H7ClO3 and a molecular weight of 150.56 g/mol. Its IUPAC name is 3-chloro-1-hydroxypentane-2,4-dione.
| Compound Name | 3-chloro-1-hydroxypentane-2,4-dione |
|---|---|
| PubChem CID | 167631445 |
| Molecular Formula | C5H7ClO3 |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 3-chloro-1-hydroxypentane-2,4-dione |
| SMILES | CC(=O)C(Cl)C(=O)CO |
| InChI | InChI=1S/C5H7ClO3/c1-3(8)5(6)4(9)2-7/h5,7H,2H2,1H3 |
| InChIKey | NWBHWLPGQSDYQR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|