About 4,6-dihydroxyhexane-2,3,5-trione
4,6-dihydroxyhexane-2,3,5-trione (PubChem CID 139577462) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is 4,6-dihydroxyhexane-2,3,5-trione.
Molecular Properties
| Compound Name | 4,6-dihydroxyhexane-2,3,5-trione |
| PubChem CID | 139577462 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4,6-dihydroxyhexane-2,3,5-trione |
| SMILES | CC(=O)C(=O)C(O)C(=O)CO |
| InChI | InChI=1S/C6H8O5/c1-3(8)5(10)6(11)4(9)2-7/h6-7,11H,2H2,1H3 |
| InChIKey | UXMPGDTVIQMEJA-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dihydroxyhexane-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dihydroxyhexane-2,3,5-trione?
The IUPAC name of 4,6-dihydroxyhexane-2,3,5-trione (CID 139577462) is 4,6-dihydroxyhexane-2,3,5-trione.
What is the SMILES notation for 4,6-dihydroxyhexane-2,3,5-trione?
The canonical SMILES for 4,6-dihydroxyhexane-2,3,5-trione is CC(=O)C(=O)C(O)C(=O)CO.
What is the InChIKey of 4,6-dihydroxyhexane-2,3,5-trione?
The InChIKey is UXMPGDTVIQMEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c1-3(8)5(10)6(11)4(9)2-7/h6-7,11H,2H2,1H3.
What are the key properties of 4,6-dihydroxyhexane-2,3,5-trione?
4,6-dihydroxyhexane-2,3,5-trione has a molecular weight of 160.12 g/mol, XLogP of -1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dihydroxyhexane-2,3,5-trione is sourced from PubChem (CID 139577462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).