C5H8O4 — CID 11506457
4,5-dihydroxy(113C)pentane-2,3-dione (PubChem CID 11506457) has the molecular formula C5H8O4 and a molecular weight of 133.11 g/mol. Its IUPAC name is 4,5-dihydroxy(113C)pentane-2,3-dione.
| Compound Name | 4,5-dihydroxy(113C)pentane-2,3-dione |
|---|---|
| PubChem CID | 11506457 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 4,5-dihydroxy(113C)pentane-2,3-dione |
| SMILES | [13CH3]C(=O)C(=O)C(O)CO |
| InChI | InChI=1S/C5H8O4/c1-3(7)5(9)4(8)2-6/h4,6,8H,2H2,1H3/i1+1 |
| InChIKey | UYTRITJAZOPLCZ-OUBTZVSYSA-N |
| XLogP | -1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|