C9H14O10-4 — CID 22325987
2,3-dihydroxypropanoate triacetate (PubChem CID 22325987) has the molecular formula C9H14O10-4 and a molecular weight of 282.20 g/mol. Its IUPAC name is 2,3-dihydroxypropanoate triacetate.
| Compound Name | 2,3-dihydroxypropanoate triacetate |
|---|---|
| PubChem CID | 22325987 |
| Molecular Formula | C9H14O10-4 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2,3-dihydroxypropanoate triacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].O=C([O-])C(O)CO |
| InChI | InChI=1S/C3H6O4.3C2H4O2/c4-1-2(5)3(6)7;3*1-2(3)4/h2,4-5H,1H2,(H,6,7);3*1H3,(H,3,4)/p-4 |
| InChIKey | KJAMTZRPEDAVDG-UHFFFAOYSA-J |
| XLogP | -6.64 |
| TPSA | 200.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |